abcBridge-0.10.0.0: abc-build/src/misc/extra/extraUtilMisc.c
/**CFile****************************************************************
FileName [extraUtilMisc.c]
SystemName [ABC: Logic synthesis and verification system.]
PackageName [extra]
Synopsis [Misc procedures.]
Author [Alan Mishchenko]
Affiliation [UC Berkeley]
Date [Ver. 1.0. Started - June 20, 2005.]
Revision [$Id: extraUtilMisc.c,v 1.0 2003/09/01 00:00:00 alanmi Exp $]
***********************************************************************/
#include <math.h>
#include "extra.h"
ABC_NAMESPACE_IMPL_START
/*---------------------------------------------------------------------------*/
/* Constant declarations */
/*---------------------------------------------------------------------------*/
/*---------------------------------------------------------------------------*/
/* Stucture declarations */
/*---------------------------------------------------------------------------*/
/*---------------------------------------------------------------------------*/
/* Type declarations */
/*---------------------------------------------------------------------------*/
/*---------------------------------------------------------------------------*/
/* Variable declarations */
/*---------------------------------------------------------------------------*/
/*---------------------------------------------------------------------------*/
/* Macro declarations */
/*---------------------------------------------------------------------------*/
/**AutomaticStart*************************************************************/
/*---------------------------------------------------------------------------*/
/* Static function prototypes */
/*---------------------------------------------------------------------------*/
/**AutomaticEnd***************************************************************/
static void Extra_Permutations_rec( char ** pRes, int nFact, int n, char Array[] );
/*---------------------------------------------------------------------------*/
/* Definition of exported functions */
/*---------------------------------------------------------------------------*/
/**Function********************************************************************
Synopsis [Finds the smallest integer larger of equal than the logarithm.]
Description []
SideEffects []
SeeAlso []
******************************************************************************/
int Extra_Base2LogDouble( double Num )
{
double Res;
int ResInt;
Res = log(Num)/log(2.0);
ResInt = (int)Res;
if ( ResInt == Res )
return ResInt;
else
return ResInt+1;
}
/**Function********************************************************************
Synopsis [Returns the power of two as a double.]
Description []
SideEffects []
SeeAlso []
******************************************************************************/
double Extra_Power2( int Degree )
{
double Res;
assert( Degree >= 0 );
if ( Degree < 32 )
return (double)(01<<Degree);
for ( Res = 1.0; Degree; Res *= 2.0, Degree-- );
return Res;
}
/**Function*************************************************************
Synopsis []
Description []
SideEffects []
SeeAlso []
***********************************************************************/
int Extra_Power3( int Num )
{
int i;
int Res;
Res = 1;
for ( i = 0; i < Num; i++ )
Res *= 3;
return Res;
}
/**Function********************************************************************
Synopsis [Finds the number of combinations of k elements out of n.]
Description []
SideEffects []
SeeAlso []
******************************************************************************/
int Extra_NumCombinations( int k, int n )
{
int i, Res = 1;
for ( i = 1; i <= k; i++ )
Res = Res * (n-i+1) / i;
return Res;
} /* end of Extra_NumCombinations */
/**Function*************************************************************
Synopsis []
Description []
SideEffects []
SeeAlso []
***********************************************************************/
int * Extra_DeriveRadixCode( int Number, int Radix, int nDigits )
{
static int Code[100];
int i;
assert( nDigits < 100 );
for ( i = 0; i < nDigits; i++ )
{
Code[i] = Number % Radix;
Number = Number / Radix;
}
assert( Number == 0 );
return Code;
}
/**Function*************************************************************
Synopsis [Counts the number of ones in the bitstring.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
int Extra_CountOnes( unsigned char * pBytes, int nBytes )
{
static int bit_count[256] = {
0,1,1,2,1,2,2,3,1,2,2,3,2,3,3,4,1,2,2,3,2,3,3,4,2,3,3,4,3,4,4,5,
1,2,2,3,2,3,3,4,2,3,3,4,3,4,4,5,2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,
1,2,2,3,2,3,3,4,2,3,3,4,3,4,4,5,2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,
2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,3,4,4,5,4,5,5,6,4,5,5,6,5,6,6,7,
1,2,2,3,2,3,3,4,2,3,3,4,3,4,4,5,2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,
2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,3,4,4,5,4,5,5,6,4,5,5,6,5,6,6,7,
2,3,3,4,3,4,4,5,3,4,4,5,4,5,5,6,3,4,4,5,4,5,5,6,4,5,5,6,5,6,6,7,
3,4,4,5,4,5,5,6,4,5,5,6,5,6,6,7,4,5,5,6,5,6,6,7,5,6,6,7,6,7,7,8
};
int i, Counter;
Counter = 0;
for ( i = 0; i < nBytes; i++ )
Counter += bit_count[ *(pBytes+i) ];
return Counter;
}
/**Function********************************************************************
Synopsis [Computes the factorial.]
Description []
SideEffects []
SeeAlso []
******************************************************************************/
int Extra_Factorial( int n )
{
int i, Res = 1;
for ( i = 1; i <= n; i++ )
Res *= i;
return Res;
}
/**Function********************************************************************
Synopsis [Computes the set of all permutations.]
Description [The number of permutations in the array is n!. The number of
entries in each permutation is n. Therefore, the resulting array is a
two-dimentional array of the size: n! x n. To free the resulting array,
call ABC_FREE() on the pointer returned by this procedure.]
SideEffects []
SeeAlso []
******************************************************************************/
char ** Extra_Permutations( int n )
{
char Array[50];
char ** pRes;
int nFact, i;
// allocate memory
nFact = Extra_Factorial( n );
pRes = (char **)Extra_ArrayAlloc( nFact, n, sizeof(char) );
// fill in the permutations
for ( i = 0; i < n; i++ )
Array[i] = i;
Extra_Permutations_rec( pRes, nFact, n, Array );
// print the permutations
/*
{
int i, k;
for ( i = 0; i < nFact; i++ )
{
printf( "{" );
for ( k = 0; k < n; k++ )
printf( " %d", pRes[i][k] );
printf( " }\n" );
}
}
*/
return pRes;
}
/**Function********************************************************************
Synopsis [Fills in the array of permutations.]
Description []
SideEffects []
SeeAlso []
******************************************************************************/
void Extra_Permutations_rec( char ** pRes, int nFact, int n, char Array[] )
{
char ** pNext;
int nFactNext;
int iTemp, iCur, iLast, k;
if ( n == 1 )
{
pRes[0][0] = Array[0];
return;
}
// get the next factorial
nFactNext = nFact / n;
// get the last entry
iLast = n - 1;
for ( iCur = 0; iCur < n; iCur++ )
{
// swap Cur and Last
iTemp = Array[iCur];
Array[iCur] = Array[iLast];
Array[iLast] = iTemp;
// get the pointer to the current section
pNext = pRes + (n - 1 - iCur) * nFactNext;
// set the last entry
for ( k = 0; k < nFactNext; k++ )
pNext[k][iLast] = Array[iLast];
// call recursively for this part
Extra_Permutations_rec( pNext, nFactNext, n - 1, Array );
// swap them back
iTemp = Array[iCur];
Array[iCur] = Array[iLast];
Array[iLast] = iTemp;
}
}
/**Function*************************************************************
Synopsis [Permutes the given vector of minterms.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
void Extra_TruthPermute_int( int * pMints, int nMints, char * pPerm, int nVars, int * pMintsP )
{
int m, v;
// clean the storage for minterms
memset( pMintsP, 0, sizeof(int) * nMints );
// go through minterms and add the variables
for ( m = 0; m < nMints; m++ )
for ( v = 0; v < nVars; v++ )
if ( pMints[m] & (1 << v) )
pMintsP[m] |= (1 << pPerm[v]);
}
/**Function*************************************************************
Synopsis [Permutes the function.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned Extra_TruthPermute( unsigned Truth, char * pPerms, int nVars, int fReverse )
{
unsigned Result;
int * pMints;
int * pMintsP;
int nMints;
int i, m;
assert( nVars < 6 );
nMints = (1 << nVars);
pMints = ABC_ALLOC( int, nMints );
pMintsP = ABC_ALLOC( int, nMints );
for ( i = 0; i < nMints; i++ )
pMints[i] = i;
Extra_TruthPermute_int( pMints, nMints, pPerms, nVars, pMintsP );
Result = 0;
if ( fReverse )
{
for ( m = 0; m < nMints; m++ )
if ( Truth & (1 << pMintsP[m]) )
Result |= (1 << m);
}
else
{
for ( m = 0; m < nMints; m++ )
if ( Truth & (1 << m) )
Result |= (1 << pMintsP[m]);
}
ABC_FREE( pMints );
ABC_FREE( pMintsP );
return Result;
}
/**Function*************************************************************
Synopsis [Changes the phase of the function.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned Extra_TruthPolarize( unsigned uTruth, int Polarity, int nVars )
{
// elementary truth tables
static unsigned Signs[5] = {
0xAAAAAAAA, // 1010 1010 1010 1010 1010 1010 1010 1010
0xCCCCCCCC, // 1010 1010 1010 1010 1010 1010 1010 1010
0xF0F0F0F0, // 1111 0000 1111 0000 1111 0000 1111 0000
0xFF00FF00, // 1111 1111 0000 0000 1111 1111 0000 0000
0xFFFF0000 // 1111 1111 1111 1111 0000 0000 0000 0000
};
unsigned uTruthRes, uCof0, uCof1;
int nMints, Shift, v;
assert( nVars < 6 );
nMints = (1 << nVars);
uTruthRes = uTruth;
for ( v = 0; v < nVars; v++ )
if ( Polarity & (1 << v) )
{
uCof0 = uTruth & ~Signs[v];
uCof1 = uTruth & Signs[v];
Shift = (1 << v);
uCof0 <<= Shift;
uCof1 >>= Shift;
uTruth = uCof0 | uCof1;
}
return uTruth;
}
/**Function*************************************************************
Synopsis [Computes N-canonical form using brute-force methods.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned Extra_TruthCanonN( unsigned uTruth, int nVars )
{
unsigned uTruthMin, uPhase;
int nMints, i;
nMints = (1 << nVars);
uTruthMin = 0xFFFFFFFF;
for ( i = 0; i < nMints; i++ )
{
uPhase = Extra_TruthPolarize( uTruth, i, nVars );
if ( uTruthMin > uPhase )
uTruthMin = uPhase;
}
return uTruthMin;
}
/**Function*************************************************************
Synopsis [Computes NN-canonical form using brute-force methods.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned Extra_TruthCanonNN( unsigned uTruth, int nVars )
{
unsigned uTruthMin, uTruthC, uPhase;
int nMints, i;
nMints = (1 << nVars);
uTruthC = (unsigned)( (~uTruth) & ((~((unsigned)0)) >> (32-nMints)) );
uTruthMin = 0xFFFFFFFF;
for ( i = 0; i < nMints; i++ )
{
uPhase = Extra_TruthPolarize( uTruth, i, nVars );
if ( uTruthMin > uPhase )
uTruthMin = uPhase;
uPhase = Extra_TruthPolarize( uTruthC, i, nVars );
if ( uTruthMin > uPhase )
uTruthMin = uPhase;
}
return uTruthMin;
}
/**Function*************************************************************
Synopsis [Computes P-canonical form using brute-force methods.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned Extra_TruthCanonP( unsigned uTruth, int nVars )
{
static int nVarsOld, nPerms;
static char ** pPerms = NULL;
unsigned uTruthMin, uPerm;
int k;
if ( pPerms == NULL )
{
nPerms = Extra_Factorial( nVars );
pPerms = Extra_Permutations( nVars );
nVarsOld = nVars;
}
else if ( nVarsOld != nVars )
{
ABC_FREE( pPerms );
nPerms = Extra_Factorial( nVars );
pPerms = Extra_Permutations( nVars );
nVarsOld = nVars;
}
uTruthMin = 0xFFFFFFFF;
for ( k = 0; k < nPerms; k++ )
{
uPerm = Extra_TruthPermute( uTruth, pPerms[k], nVars, 0 );
if ( uTruthMin > uPerm )
uTruthMin = uPerm;
}
return uTruthMin;
}
/**Function*************************************************************
Synopsis [Computes NP-canonical form using brute-force methods.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned Extra_TruthCanonNP( unsigned uTruth, int nVars )
{
static int nVarsOld, nPerms;
static char ** pPerms = NULL;
unsigned uTruthMin, uPhase, uPerm;
int nMints, k, i;
if ( pPerms == NULL )
{
nPerms = Extra_Factorial( nVars );
pPerms = Extra_Permutations( nVars );
nVarsOld = nVars;
}
else if ( nVarsOld != nVars )
{
ABC_FREE( pPerms );
nPerms = Extra_Factorial( nVars );
pPerms = Extra_Permutations( nVars );
nVarsOld = nVars;
}
nMints = (1 << nVars);
uTruthMin = 0xFFFFFFFF;
for ( i = 0; i < nMints; i++ )
{
uPhase = Extra_TruthPolarize( uTruth, i, nVars );
for ( k = 0; k < nPerms; k++ )
{
uPerm = Extra_TruthPermute( uPhase, pPerms[k], nVars, 0 );
if ( uTruthMin > uPerm )
uTruthMin = uPerm;
}
}
return uTruthMin;
}
/**Function*************************************************************
Synopsis [Computes NPN-canonical form using brute-force methods.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned Extra_TruthCanonNPN( unsigned uTruth, int nVars )
{
static int nVarsOld, nPerms;
static char ** pPerms = NULL;
unsigned uTruthMin, uTruthC, uPhase, uPerm;
int nMints, k, i;
if ( pPerms == NULL )
{
nPerms = Extra_Factorial( nVars );
pPerms = Extra_Permutations( nVars );
nVarsOld = nVars;
}
else if ( nVarsOld != nVars )
{
ABC_FREE( pPerms );
nPerms = Extra_Factorial( nVars );
pPerms = Extra_Permutations( nVars );
nVarsOld = nVars;
}
nMints = (1 << nVars);
uTruthC = (unsigned)( (~uTruth) & ((~((unsigned)0)) >> (32-nMints)) );
uTruthMin = 0xFFFFFFFF;
for ( i = 0; i < nMints; i++ )
{
uPhase = Extra_TruthPolarize( uTruth, i, nVars );
for ( k = 0; k < nPerms; k++ )
{
uPerm = Extra_TruthPermute( uPhase, pPerms[k], nVars, 0 );
if ( uTruthMin > uPerm )
uTruthMin = uPerm;
}
uPhase = Extra_TruthPolarize( uTruthC, i, nVars );
for ( k = 0; k < nPerms; k++ )
{
uPerm = Extra_TruthPermute( uPhase, pPerms[k], nVars, 0 );
if ( uTruthMin > uPerm )
uTruthMin = uPerm;
}
}
return uTruthMin;
}
/**Function*************************************************************
Synopsis [Computes NPN canonical forms for 4-variable functions.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
void Extra_Truth4VarNPN( unsigned short ** puCanons, char ** puPhases, char ** puPerms, unsigned char ** puMap )
{
unsigned short * uCanons;
unsigned char * uMap;
unsigned uTruth, uPhase, uPerm;
char ** pPerms4, * uPhases, * uPerms;
int nFuncs, nClasses;
int i, k;
nFuncs = (1 << 16);
uCanons = ABC_ALLOC( unsigned short, nFuncs );
uPhases = ABC_ALLOC( char, nFuncs );
uPerms = ABC_ALLOC( char, nFuncs );
uMap = ABC_ALLOC( unsigned char, nFuncs );
memset( uCanons, 0, sizeof(unsigned short) * nFuncs );
memset( uPhases, 0, sizeof(char) * nFuncs );
memset( uPerms, 0, sizeof(char) * nFuncs );
memset( uMap, 0, sizeof(unsigned char) * nFuncs );
pPerms4 = Extra_Permutations( 4 );
nClasses = 1;
nFuncs = (1 << 15);
for ( uTruth = 1; uTruth < (unsigned)nFuncs; uTruth++ )
{
// skip already assigned
if ( uCanons[uTruth] )
{
assert( uTruth > uCanons[uTruth] );
uMap[~uTruth & 0xFFFF] = uMap[uTruth] = uMap[uCanons[uTruth]];
continue;
}
uMap[uTruth] = nClasses++;
for ( i = 0; i < 16; i++ )
{
uPhase = Extra_TruthPolarize( uTruth, i, 4 );
for ( k = 0; k < 24; k++ )
{
uPerm = Extra_TruthPermute( uPhase, pPerms4[k], 4, 0 );
if ( uCanons[uPerm] == 0 )
{
uCanons[uPerm] = uTruth;
uPhases[uPerm] = i;
uPerms[uPerm] = k;
uPerm = ~uPerm & 0xFFFF;
uCanons[uPerm] = uTruth;
uPhases[uPerm] = i | 16;
uPerms[uPerm] = k;
}
else
assert( uCanons[uPerm] == uTruth );
}
uPhase = Extra_TruthPolarize( ~uTruth & 0xFFFF, i, 4 );
for ( k = 0; k < 24; k++ )
{
uPerm = Extra_TruthPermute( uPhase, pPerms4[k], 4, 0 );
if ( uCanons[uPerm] == 0 )
{
uCanons[uPerm] = uTruth;
uPhases[uPerm] = i;
uPerms[uPerm] = k;
uPerm = ~uPerm & 0xFFFF;
uCanons[uPerm] = uTruth;
uPhases[uPerm] = i | 16;
uPerms[uPerm] = k;
}
else
assert( uCanons[uPerm] == uTruth );
}
}
}
uPhases[(1<<16)-1] = 16;
assert( nClasses == 222 );
ABC_FREE( pPerms4 );
if ( puCanons )
*puCanons = uCanons;
else
ABC_FREE( uCanons );
if ( puPhases )
*puPhases = uPhases;
else
ABC_FREE( uPhases );
if ( puPerms )
*puPerms = uPerms;
else
ABC_FREE( uPerms );
if ( puMap )
*puMap = uMap;
else
ABC_FREE( uMap );
}
/**Function*************************************************************
Synopsis [Computes NPN canonical forms for 4-variable functions.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
void Extra_Truth3VarN( unsigned ** puCanons, char *** puPhases, char ** ppCounters )
{
int nPhasesMax = 8;
unsigned * uCanons;
unsigned uTruth, uPhase, uTruth32;
char ** uPhases, * pCounters;
int nFuncs, nClasses, i;
nFuncs = (1 << 8);
uCanons = ABC_ALLOC( unsigned, nFuncs );
memset( uCanons, 0, sizeof(unsigned) * nFuncs );
pCounters = ABC_ALLOC( char, nFuncs );
memset( pCounters, 0, sizeof(char) * nFuncs );
uPhases = (char **)Extra_ArrayAlloc( nFuncs, nPhasesMax, sizeof(char) );
nClasses = 0;
for ( uTruth = 0; uTruth < (unsigned)nFuncs; uTruth++ )
{
// skip already assigned
uTruth32 = ((uTruth << 24) | (uTruth << 16) | (uTruth << 8) | uTruth);
if ( uCanons[uTruth] )
{
assert( uTruth32 > uCanons[uTruth] );
continue;
}
nClasses++;
for ( i = 0; i < 8; i++ )
{
uPhase = Extra_TruthPolarize( uTruth, i, 3 );
if ( uCanons[uPhase] == 0 && (uTruth || i==0) )
{
uCanons[uPhase] = uTruth32;
uPhases[uPhase][0] = i;
pCounters[uPhase] = 1;
}
else
{
assert( uCanons[uPhase] == uTruth32 );
if ( pCounters[uPhase] < nPhasesMax )
uPhases[uPhase][ (int)pCounters[uPhase]++ ] = i;
}
}
}
if ( puCanons )
*puCanons = uCanons;
else
ABC_FREE( uCanons );
if ( puPhases )
*puPhases = uPhases;
else
ABC_FREE( uPhases );
if ( ppCounters )
*ppCounters = pCounters;
else
ABC_FREE( pCounters );
// printf( "The number of 3N-classes = %d.\n", nClasses );
}
/**Function*************************************************************
Synopsis [Computes NPN canonical forms for 4-variable functions.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
void Extra_Truth4VarN( unsigned short ** puCanons, char *** puPhases, char ** ppCounters, int nPhasesMax )
{
unsigned short * uCanons;
unsigned uTruth, uPhase;
char ** uPhases, * pCounters;
int nFuncs, nClasses, i;
nFuncs = (1 << 16);
uCanons = ABC_ALLOC( unsigned short, nFuncs );
memset( uCanons, 0, sizeof(unsigned short) * nFuncs );
pCounters = ABC_ALLOC( char, nFuncs );
memset( pCounters, 0, sizeof(char) * nFuncs );
uPhases = (char **)Extra_ArrayAlloc( nFuncs, nPhasesMax, sizeof(char) );
nClasses = 0;
for ( uTruth = 0; uTruth < (unsigned)nFuncs; uTruth++ )
{
// skip already assigned
if ( uCanons[uTruth] )
{
assert( uTruth > uCanons[uTruth] );
continue;
}
nClasses++;
for ( i = 0; i < 16; i++ )
{
uPhase = Extra_TruthPolarize( uTruth, i, 4 );
if ( uCanons[uPhase] == 0 && (uTruth || i==0) )
{
uCanons[uPhase] = uTruth;
uPhases[uPhase][0] = i;
pCounters[uPhase] = 1;
}
else
{
assert( uCanons[uPhase] == uTruth );
if ( pCounters[uPhase] < nPhasesMax )
uPhases[uPhase][ (int)pCounters[uPhase]++ ] = i;
}
}
}
if ( puCanons )
*puCanons = uCanons;
else
ABC_FREE( uCanons );
if ( puPhases )
*puPhases = uPhases;
else
ABC_FREE( uPhases );
if ( ppCounters )
*ppCounters = pCounters;
else
ABC_FREE( pCounters );
// printf( "The number of 4N-classes = %d.\n", nClasses );
}
/**Function*************************************************************
Synopsis [Allocated one-memory-chunk array.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
void ** Extra_ArrayAlloc( int nCols, int nRows, int Size )
{
void ** pRes;
char * pBuffer;
int i;
assert( nCols > 0 && nRows > 0 && Size > 0 );
pBuffer = ABC_ALLOC( char, nCols * (sizeof(void *) + nRows * Size) );
pRes = (void **)pBuffer;
pRes[0] = pBuffer + nCols * sizeof(void *);
for ( i = 1; i < nCols; i++ )
pRes[i] = (void *)((char *)pRes[0] + i * nRows * Size);
return pRes;
}
/**Function*************************************************************
Synopsis [Computes a phase of the 3-var function.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned short Extra_TruthPerm4One( unsigned uTruth, int Phase )
{
// cases
static unsigned short Cases[16] = {
0, // 0000 - skip
0, // 0001 - skip
0xCCCC, // 0010 - single var
0, // 0011 - skip
0xF0F0, // 0100 - single var
1, // 0101
1, // 0110
0, // 0111 - skip
0xFF00, // 1000 - single var
1, // 1001
1, // 1010
1, // 1011
1, // 1100
1, // 1101
1, // 1110
0 // 1111 - skip
};
// permutations
static int Perms[16][4] = {
{ 0, 0, 0, 0 }, // 0000 - skip
{ 0, 0, 0, 0 }, // 0001 - skip
{ 0, 0, 0, 0 }, // 0010 - single var
{ 0, 0, 0, 0 }, // 0011 - skip
{ 0, 0, 0, 0 }, // 0100 - single var
{ 0, 2, 1, 3 }, // 0101
{ 2, 0, 1, 3 }, // 0110
{ 0, 0, 0, 0 }, // 0111 - skip
{ 0, 0, 0, 0 }, // 1000 - single var
{ 0, 2, 3, 1 }, // 1001
{ 2, 0, 3, 1 }, // 1010
{ 0, 1, 3, 2 }, // 1011
{ 2, 3, 0, 1 }, // 1100
{ 0, 3, 1, 2 }, // 1101
{ 3, 0, 1, 2 }, // 1110
{ 0, 0, 0, 0 } // 1111 - skip
};
int i, k, iRes;
unsigned uTruthRes;
assert( Phase >= 0 && Phase < 16 );
if ( Cases[Phase] == 0 )
return uTruth;
if ( Cases[Phase] > 1 )
return Cases[Phase];
uTruthRes = 0;
for ( i = 0; i < 16; i++ )
if ( uTruth & (1 << i) )
{
for ( iRes = 0, k = 0; k < 4; k++ )
if ( i & (1 << Perms[Phase][k]) )
iRes |= (1 << k);
uTruthRes |= (1 << iRes);
}
return uTruthRes;
}
/**Function*************************************************************
Synopsis [Computes a phase of the 3-var function.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned Extra_TruthPerm5One( unsigned uTruth, int Phase )
{
// cases
static unsigned Cases[32] = {
0, // 00000 - skip
0, // 00001 - skip
0xCCCCCCCC, // 00010 - single var
0, // 00011 - skip
0xF0F0F0F0, // 00100 - single var
1, // 00101
1, // 00110
0, // 00111 - skip
0xFF00FF00, // 01000 - single var
1, // 01001
1, // 01010
1, // 01011
1, // 01100
1, // 01101
1, // 01110
0, // 01111 - skip
0xFFFF0000, // 10000 - skip
1, // 10001
1, // 10010
1, // 10011
1, // 10100
1, // 10101
1, // 10110
1, // 10111 - four var
1, // 11000
1, // 11001
1, // 11010
1, // 11011 - four var
1, // 11100
1, // 11101 - four var
1, // 11110 - four var
0 // 11111 - skip
};
// permutations
static int Perms[32][5] = {
{ 0, 0, 0, 0, 0 }, // 00000 - skip
{ 0, 0, 0, 0, 0 }, // 00001 - skip
{ 0, 0, 0, 0, 0 }, // 00010 - single var
{ 0, 0, 0, 0, 0 }, // 00011 - skip
{ 0, 0, 0, 0, 0 }, // 00100 - single var
{ 0, 2, 1, 3, 4 }, // 00101
{ 2, 0, 1, 3, 4 }, // 00110
{ 0, 0, 0, 0, 0 }, // 00111 - skip
{ 0, 0, 0, 0, 0 }, // 01000 - single var
{ 0, 2, 3, 1, 4 }, // 01001
{ 2, 0, 3, 1, 4 }, // 01010
{ 0, 1, 3, 2, 4 }, // 01011
{ 2, 3, 0, 1, 4 }, // 01100
{ 0, 3, 1, 2, 4 }, // 01101
{ 3, 0, 1, 2, 4 }, // 01110
{ 0, 0, 0, 0, 0 }, // 01111 - skip
{ 0, 0, 0, 0, 0 }, // 10000 - single var
{ 0, 4, 2, 3, 1 }, // 10001
{ 4, 0, 2, 3, 1 }, // 10010
{ 0, 1, 3, 4, 2 }, // 10011
{ 2, 3, 0, 4, 1 }, // 10100
{ 0, 3, 1, 4, 2 }, // 10101
{ 3, 0, 1, 4, 2 }, // 10110
{ 0, 1, 2, 4, 3 }, // 10111 - four var
{ 2, 3, 4, 0, 1 }, // 11000
{ 0, 3, 4, 1, 2 }, // 11001
{ 3, 0, 4, 1, 2 }, // 11010
{ 0, 1, 4, 2, 3 }, // 11011 - four var
{ 3, 4, 0, 1, 2 }, // 11100
{ 0, 4, 1, 2, 3 }, // 11101 - four var
{ 4, 0, 1, 2, 3 }, // 11110 - four var
{ 0, 0, 0, 0, 0 } // 11111 - skip
};
int i, k, iRes;
unsigned uTruthRes;
assert( Phase >= 0 && Phase < 32 );
if ( Cases[Phase] == 0 )
return uTruth;
if ( Cases[Phase] > 1 )
return Cases[Phase];
uTruthRes = 0;
for ( i = 0; i < 32; i++ )
if ( uTruth & (1 << i) )
{
for ( iRes = 0, k = 0; k < 5; k++ )
if ( i & (1 << Perms[Phase][k]) )
iRes |= (1 << k);
uTruthRes |= (1 << iRes);
}
return uTruthRes;
}
/**Function*************************************************************
Synopsis [Computes a phase of the 3-var function.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
void Extra_TruthPerm6One( unsigned * uTruth, int Phase, unsigned * uTruthRes )
{
// cases
static unsigned Cases[64] = {
0, // 000000 - skip
0, // 000001 - skip
0xCCCCCCCC, // 000010 - single var
0, // 000011 - skip
0xF0F0F0F0, // 000100 - single var
1, // 000101
1, // 000110
0, // 000111 - skip
0xFF00FF00, // 001000 - single var
1, // 001001
1, // 001010
1, // 001011
1, // 001100
1, // 001101
1, // 001110
0, // 001111 - skip
0xFFFF0000, // 010000 - skip
1, // 010001
1, // 010010
1, // 010011
1, // 010100
1, // 010101
1, // 010110
1, // 010111 - four var
1, // 011000
1, // 011001
1, // 011010
1, // 011011 - four var
1, // 011100
1, // 011101 - four var
1, // 011110 - four var
0, // 011111 - skip
0xFFFFFFFF, // 100000 - single var
1, // 100001
1, // 100010
1, // 100011
1, // 100100
1, // 100101
1, // 100110
1, // 100111
1, // 101000
1, // 101001
1, // 101010
1, // 101011
1, // 101100
1, // 101101
1, // 101110
1, // 101111
1, // 110000
1, // 110001
1, // 110010
1, // 110011
1, // 110100
1, // 110101
1, // 110110
1, // 110111
1, // 111000
1, // 111001
1, // 111010
1, // 111011
1, // 111100
1, // 111101
1, // 111110
0 // 111111 - skip
};
// permutations
static int Perms[64][6] = {
{ 0, 0, 0, 0, 0, 0 }, // 000000 - skip
{ 0, 0, 0, 0, 0, 0 }, // 000001 - skip
{ 0, 0, 0, 0, 0, 0 }, // 000010 - single var
{ 0, 0, 0, 0, 0, 0 }, // 000011 - skip
{ 0, 0, 0, 0, 0, 0 }, // 000100 - single var
{ 0, 2, 1, 3, 4, 5 }, // 000101
{ 2, 0, 1, 3, 4, 5 }, // 000110
{ 0, 0, 0, 0, 0, 0 }, // 000111 - skip
{ 0, 0, 0, 0, 0, 0 }, // 001000 - single var
{ 0, 2, 3, 1, 4, 5 }, // 001001
{ 2, 0, 3, 1, 4, 5 }, // 001010
{ 0, 1, 3, 2, 4, 5 }, // 001011
{ 2, 3, 0, 1, 4, 5 }, // 001100
{ 0, 3, 1, 2, 4, 5 }, // 001101
{ 3, 0, 1, 2, 4, 5 }, // 001110
{ 0, 0, 0, 0, 0, 0 }, // 001111 - skip
{ 0, 0, 0, 0, 0, 0 }, // 010000 - skip
{ 0, 4, 2, 3, 1, 5 }, // 010001
{ 4, 0, 2, 3, 1, 5 }, // 010010
{ 0, 1, 3, 4, 2, 5 }, // 010011
{ 2, 3, 0, 4, 1, 5 }, // 010100
{ 0, 3, 1, 4, 2, 5 }, // 010101
{ 3, 0, 1, 4, 2, 5 }, // 010110
{ 0, 1, 2, 4, 3, 5 }, // 010111 - four var
{ 2, 3, 4, 0, 1, 5 }, // 011000
{ 0, 3, 4, 1, 2, 5 }, // 011001
{ 3, 0, 4, 1, 2, 5 }, // 011010
{ 0, 1, 4, 2, 3, 5 }, // 011011 - four var
{ 3, 4, 0, 1, 2, 5 }, // 011100
{ 0, 4, 1, 2, 3, 5 }, // 011101 - four var
{ 4, 0, 1, 2, 3, 5 }, // 011110 - four var
{ 0, 0, 0, 0, 0, 0 }, // 011111 - skip
{ 0, 0, 0, 0, 0, 0 }, // 100000 - single var
{ 0, 2, 3, 4, 5, 1 }, // 100001
{ 2, 0, 3, 4, 5, 1 }, // 100010
{ 0, 1, 3, 4, 5, 2 }, // 100011
{ 2, 3, 0, 4, 5, 1 }, // 100100
{ 0, 3, 1, 4, 5, 2 }, // 100101
{ 3, 0, 1, 4, 5, 2 }, // 100110
{ 0, 1, 2, 4, 5, 3 }, // 100111
{ 2, 3, 4, 0, 5, 1 }, // 101000
{ 0, 3, 4, 1, 5, 2 }, // 101001
{ 3, 0, 4, 1, 5, 2 }, // 101010
{ 0, 1, 4, 2, 5, 3 }, // 101011
{ 3, 4, 0, 1, 5, 2 }, // 101100
{ 0, 4, 1, 2, 5, 3 }, // 101101
{ 4, 0, 1, 2, 5, 3 }, // 101110
{ 0, 1, 2, 3, 5, 4 }, // 101111
{ 2, 3, 4, 5, 0, 1 }, // 110000
{ 0, 3, 4, 5, 1, 2 }, // 110001
{ 3, 0, 4, 5, 1, 2 }, // 110010
{ 0, 1, 4, 5, 2, 3 }, // 110011
{ 3, 4, 0, 5, 1, 2 }, // 110100
{ 0, 4, 1, 5, 2, 3 }, // 110101
{ 4, 0, 1, 5, 2, 3 }, // 110110
{ 0, 1, 2, 5, 3, 4 }, // 110111
{ 3, 4, 5, 0, 1, 2 }, // 111000
{ 0, 4, 5, 1, 2, 3 }, // 111001
{ 4, 0, 5, 1, 2, 3 }, // 111010
{ 0, 1, 5, 2, 3, 4 }, // 111011
{ 4, 5, 0, 1, 2, 3 }, // 111100
{ 0, 5, 1, 2, 3, 4 }, // 111101
{ 5, 0, 1, 2, 3, 4 }, // 111110
{ 0, 0, 0, 0, 0, 0 } // 111111 - skip
};
int i, k, iRes;
assert( Phase >= 0 && Phase < 64 );
if ( Cases[Phase] == 0 )
{
uTruthRes[0] = uTruth[0];
uTruthRes[1] = uTruth[1];
return;
}
if ( Cases[Phase] > 1 )
{
if ( Phase == 32 )
{
uTruthRes[0] = 0x00000000;
uTruthRes[1] = 0xFFFFFFFF;
}
else
{
uTruthRes[0] = Cases[Phase];
uTruthRes[1] = Cases[Phase];
}
return;
}
uTruthRes[0] = 0;
uTruthRes[1] = 0;
for ( i = 0; i < 64; i++ )
{
if ( i < 32 )
{
if ( uTruth[0] & (1 << i) )
{
for ( iRes = 0, k = 0; k < 6; k++ )
if ( i & (1 << Perms[Phase][k]) )
iRes |= (1 << k);
if ( iRes < 32 )
uTruthRes[0] |= (1 << iRes);
else
uTruthRes[1] |= (1 << (iRes-32));
}
}
else
{
if ( uTruth[1] & (1 << (i-32)) )
{
for ( iRes = 0, k = 0; k < 6; k++ )
if ( i & (1 << Perms[Phase][k]) )
iRes |= (1 << k);
if ( iRes < 32 )
uTruthRes[0] |= (1 << iRes);
else
uTruthRes[1] |= (1 << (iRes-32));
}
}
}
}
/**Function*************************************************************
Synopsis [Computes a phase of the 8-var function.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
void Extra_TruthExpand( int nVars, int nWords, unsigned * puTruth, unsigned uPhase, unsigned * puTruthR )
{
// elementary truth tables
static unsigned uTruths[8][8] = {
{ 0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA },
{ 0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC },
{ 0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0 },
{ 0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00 },
{ 0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000 },
{ 0x00000000,0xFFFFFFFF,0x00000000,0xFFFFFFFF,0x00000000,0xFFFFFFFF,0x00000000,0xFFFFFFFF },
{ 0x00000000,0x00000000,0xFFFFFFFF,0xFFFFFFFF,0x00000000,0x00000000,0xFFFFFFFF,0xFFFFFFFF },
{ 0x00000000,0x00000000,0x00000000,0x00000000,0xFFFFFFFF,0xFFFFFFFF,0xFFFFFFFF,0xFFFFFFFF }
};
static char Cases[256] = {
0, // 00000000
0, // 00000001
1, // 00000010
0, // 00000011
2, // 00000100
-1, // 00000101
-1, // 00000110
0, // 00000111
3, // 00001000
-1, // 00001001
-1, // 00001010
-1, // 00001011
-1, // 00001100
-1, // 00001101
-1, // 00001110
0, // 00001111
4, // 00010000
-1, // 00010001
-1, // 00010010
-1, // 00010011
-1, // 00010100
-1, // 00010101
-1, // 00010110
-1, // 00010111
-1, // 00011000
-1, // 00011001
-1, // 00011010
-1, // 00011011
-1, // 00011100
-1, // 00011101
-1, // 00011110
0, // 00011111
5, // 00100000
-1, // 00100001
-1, // 00100010
-1, // 00100011
-1, // 00100100
-1, // 00100101
-1, // 00100110
-1, // 00100111
-1, // 00101000
-1, // 00101001
-1, // 00101010
-1, // 00101011
-1, // 00101100
-1, // 00101101
-1, // 00101110
-1, // 00101111
-1, // 00110000
-1, // 00110001
-1, // 00110010
-1, // 00110011
-1, // 00110100
-1, // 00110101
-1, // 00110110
-1, // 00110111
-1, // 00111000
-1, // 00111001
-1, // 00111010
-1, // 00111011
-1, // 00111100
-1, // 00111101
-1, // 00111110
0, // 00111111
6, // 01000000
-1, // 01000001
-1, // 01000010
-1, // 01000011
-1, // 01000100
-1, // 01000101
-1, // 01000110
-1, // 01000111
-1, // 01001000
-1, // 01001001
-1, // 01001010
-1, // 01001011
-1, // 01001100
-1, // 01001101
-1, // 01001110
-1, // 01001111
-1, // 01010000
-1, // 01010001
-1, // 01010010
-1, // 01010011
-1, // 01010100
-1, // 01010101
-1, // 01010110
-1, // 01010111
-1, // 01011000
-1, // 01011001
-1, // 01011010
-1, // 01011011
-1, // 01011100
-1, // 01011101
-1, // 01011110
-1, // 01011111
-1, // 01100000
-1, // 01100001
-1, // 01100010
-1, // 01100011
-1, // 01100100
-1, // 01100101
-1, // 01100110
-1, // 01100111
-1, // 01101000
-1, // 01101001
-1, // 01101010
-1, // 01101011
-1, // 01101100
-1, // 01101101
-1, // 01101110
-1, // 01101111
-1, // 01110000
-1, // 01110001
-1, // 01110010
-1, // 01110011
-1, // 01110100
-1, // 01110101
-1, // 01110110
-1, // 01110111
-1, // 01111000
-1, // 01111001
-1, // 01111010
-1, // 01111011
-1, // 01111100
-1, // 01111101
-1, // 01111110
0, // 01111111
7, // 10000000
-1, // 10000001
-1, // 10000010
-1, // 10000011
-1, // 10000100
-1, // 10000101
-1, // 10000110
-1, // 10000111
-1, // 10001000
-1, // 10001001
-1, // 10001010
-1, // 10001011
-1, // 10001100
-1, // 10001101
-1, // 10001110
-1, // 10001111
-1, // 10010000
-1, // 10010001
-1, // 10010010
-1, // 10010011
-1, // 10010100
-1, // 10010101
-1, // 10010110
-1, // 10010111
-1, // 10011000
-1, // 10011001
-1, // 10011010
-1, // 10011011
-1, // 10011100
-1, // 10011101
-1, // 10011110
-1, // 10011111
-1, // 10100000
-1, // 10100001
-1, // 10100010
-1, // 10100011
-1, // 10100100
-1, // 10100101
-1, // 10100110
-1, // 10100111
-1, // 10101000
-1, // 10101001
-1, // 10101010
-1, // 10101011
-1, // 10101100
-1, // 10101101
-1, // 10101110
-1, // 10101111
-1, // 10110000
-1, // 10110001
-1, // 10110010
-1, // 10110011
-1, // 10110100
-1, // 10110101
-1, // 10110110
-1, // 10110111
-1, // 10111000
-1, // 10111001
-1, // 10111010
-1, // 10111011
-1, // 10111100
-1, // 10111101
-1, // 10111110
-1, // 10111111
-1, // 11000000
-1, // 11000001
-1, // 11000010
-1, // 11000011
-1, // 11000100
-1, // 11000101
-1, // 11000110
-1, // 11000111
-1, // 11001000
-1, // 11001001
-1, // 11001010
-1, // 11001011
-1, // 11001100
-1, // 11001101
-1, // 11001110
-1, // 11001111
-1, // 11010000
-1, // 11010001
-1, // 11010010
-1, // 11010011
-1, // 11010100
-1, // 11010101
-1, // 11010110
-1, // 11010111
-1, // 11011000
-1, // 11011001
-1, // 11011010
-1, // 11011011
-1, // 11011100
-1, // 11011101
-1, // 11011110
-1, // 11011111
-1, // 11100000
-1, // 11100001
-1, // 11100010
-1, // 11100011
-1, // 11100100
-1, // 11100101
-1, // 11100110
-1, // 11100111
-1, // 11101000
-1, // 11101001
-1, // 11101010
-1, // 11101011
-1, // 11101100
-1, // 11101101
-1, // 11101110
-1, // 11101111
-1, // 11110000
-1, // 11110001
-1, // 11110010
-1, // 11110011
-1, // 11110100
-1, // 11110101
-1, // 11110110
-1, // 11110111
-1, // 11111000
-1, // 11111001
-1, // 11111010
-1, // 11111011
-1, // 11111100
-1, // 11111101
-1, // 11111110
0 // 11111111
};
static char Perms[256][8] = {
{ 0, 1, 2, 3, 4, 5, 6, 7 }, // 00000000
{ 0, 1, 2, 3, 4, 5, 6, 7 }, // 00000001
{ 1, 0, 2, 3, 4, 5, 6, 7 }, // 00000010
{ 0, 1, 2, 3, 4, 5, 6, 7 }, // 00000011
{ 1, 2, 0, 3, 4, 5, 6, 7 }, // 00000100
{ 0, 2, 1, 3, 4, 5, 6, 7 }, // 00000101
{ 2, 0, 1, 3, 4, 5, 6, 7 }, // 00000110
{ 0, 1, 2, 3, 4, 5, 6, 7 }, // 00000111
{ 1, 2, 3, 0, 4, 5, 6, 7 }, // 00001000
{ 0, 2, 3, 1, 4, 5, 6, 7 }, // 00001001
{ 2, 0, 3, 1, 4, 5, 6, 7 }, // 00001010
{ 0, 1, 3, 2, 4, 5, 6, 7 }, // 00001011
{ 2, 3, 0, 1, 4, 5, 6, 7 }, // 00001100
{ 0, 3, 1, 2, 4, 5, 6, 7 }, // 00001101
{ 3, 0, 1, 2, 4, 5, 6, 7 }, // 00001110
{ 0, 1, 2, 3, 4, 5, 6, 7 }, // 00001111
{ 1, 2, 3, 4, 0, 5, 6, 7 }, // 00010000
{ 0, 2, 3, 4, 1, 5, 6, 7 }, // 00010001
{ 2, 0, 3, 4, 1, 5, 6, 7 }, // 00010010
{ 0, 1, 3, 4, 2, 5, 6, 7 }, // 00010011
{ 2, 3, 0, 4, 1, 5, 6, 7 }, // 00010100
{ 0, 3, 1, 4, 2, 5, 6, 7 }, // 00010101
{ 3, 0, 1, 4, 2, 5, 6, 7 }, // 00010110
{ 0, 1, 2, 4, 3, 5, 6, 7 }, // 00010111
{ 2, 3, 4, 0, 1, 5, 6, 7 }, // 00011000
{ 0, 3, 4, 1, 2, 5, 6, 7 }, // 00011001
{ 3, 0, 4, 1, 2, 5, 6, 7 }, // 00011010
{ 0, 1, 4, 2, 3, 5, 6, 7 }, // 00011011
{ 3, 4, 0, 1, 2, 5, 6, 7 }, // 00011100
{ 0, 4, 1, 2, 3, 5, 6, 7 }, // 00011101
{ 4, 0, 1, 2, 3, 5, 6, 7 }, // 00011110
{ 0, 1, 2, 3, 4, 5, 6, 7 }, // 00011111
{ 1, 2, 3, 4, 5, 0, 6, 7 }, // 00100000
{ 0, 2, 3, 4, 5, 1, 6, 7 }, // 00100001
{ 2, 0, 3, 4, 5, 1, 6, 7 }, // 00100010
{ 0, 1, 3, 4, 5, 2, 6, 7 }, // 00100011
{ 2, 3, 0, 4, 5, 1, 6, 7 }, // 00100100
{ 0, 3, 1, 4, 5, 2, 6, 7 }, // 00100101
{ 3, 0, 1, 4, 5, 2, 6, 7 }, // 00100110
{ 0, 1, 2, 4, 5, 3, 6, 7 }, // 00100111
{ 2, 3, 4, 0, 5, 1, 6, 7 }, // 00101000
{ 0, 3, 4, 1, 5, 2, 6, 7 }, // 00101001
{ 3, 0, 4, 1, 5, 2, 6, 7 }, // 00101010
{ 0, 1, 4, 2, 5, 3, 6, 7 }, // 00101011
{ 3, 4, 0, 1, 5, 2, 6, 7 }, // 00101100
{ 0, 4, 1, 2, 5, 3, 6, 7 }, // 00101101
{ 4, 0, 1, 2, 5, 3, 6, 7 }, // 00101110
{ 0, 1, 2, 3, 5, 4, 6, 7 }, // 00101111
{ 2, 3, 4, 5, 0, 1, 6, 7 }, // 00110000
{ 0, 3, 4, 5, 1, 2, 6, 7 }, // 00110001
{ 3, 0, 4, 5, 1, 2, 6, 7 }, // 00110010
{ 0, 1, 4, 5, 2, 3, 6, 7 }, // 00110011
{ 3, 4, 0, 5, 1, 2, 6, 7 }, // 00110100
{ 0, 4, 1, 5, 2, 3, 6, 7 }, // 00110101
{ 4, 0, 1, 5, 2, 3, 6, 7 }, // 00110110
{ 0, 1, 2, 5, 3, 4, 6, 7 }, // 00110111
{ 3, 4, 5, 0, 1, 2, 6, 7 }, // 00111000
{ 0, 4, 5, 1, 2, 3, 6, 7 }, // 00111001
{ 4, 0, 5, 1, 2, 3, 6, 7 }, // 00111010
{ 0, 1, 5, 2, 3, 4, 6, 7 }, // 00111011
{ 4, 5, 0, 1, 2, 3, 6, 7 }, // 00111100
{ 0, 5, 1, 2, 3, 4, 6, 7 }, // 00111101
{ 5, 0, 1, 2, 3, 4, 6, 7 }, // 00111110
{ 0, 1, 2, 3, 4, 5, 6, 7 }, // 00111111
{ 1, 2, 3, 4, 5, 6, 0, 7 }, // 01000000
{ 0, 2, 3, 4, 5, 6, 1, 7 }, // 01000001
{ 2, 0, 3, 4, 5, 6, 1, 7 }, // 01000010
{ 0, 1, 3, 4, 5, 6, 2, 7 }, // 01000011
{ 2, 3, 0, 4, 5, 6, 1, 7 }, // 01000100
{ 0, 3, 1, 4, 5, 6, 2, 7 }, // 01000101
{ 3, 0, 1, 4, 5, 6, 2, 7 }, // 01000110
{ 0, 1, 2, 4, 5, 6, 3, 7 }, // 01000111
{ 2, 3, 4, 0, 5, 6, 1, 7 }, // 01001000
{ 0, 3, 4, 1, 5, 6, 2, 7 }, // 01001001
{ 3, 0, 4, 1, 5, 6, 2, 7 }, // 01001010
{ 0, 1, 4, 2, 5, 6, 3, 7 }, // 01001011
{ 3, 4, 0, 1, 5, 6, 2, 7 }, // 01001100
{ 0, 4, 1, 2, 5, 6, 3, 7 }, // 01001101
{ 4, 0, 1, 2, 5, 6, 3, 7 }, // 01001110
{ 0, 1, 2, 3, 5, 6, 4, 7 }, // 01001111
{ 2, 3, 4, 5, 0, 6, 1, 7 }, // 01010000
{ 0, 3, 4, 5, 1, 6, 2, 7 }, // 01010001
{ 3, 0, 4, 5, 1, 6, 2, 7 }, // 01010010
{ 0, 1, 4, 5, 2, 6, 3, 7 }, // 01010011
{ 3, 4, 0, 5, 1, 6, 2, 7 }, // 01010100
{ 0, 4, 1, 5, 2, 6, 3, 7 }, // 01010101
{ 4, 0, 1, 5, 2, 6, 3, 7 }, // 01010110
{ 0, 1, 2, 5, 3, 6, 4, 7 }, // 01010111
{ 3, 4, 5, 0, 1, 6, 2, 7 }, // 01011000
{ 0, 4, 5, 1, 2, 6, 3, 7 }, // 01011001
{ 4, 0, 5, 1, 2, 6, 3, 7 }, // 01011010
{ 0, 1, 5, 2, 3, 6, 4, 7 }, // 01011011
{ 4, 5, 0, 1, 2, 6, 3, 7 }, // 01011100
{ 0, 5, 1, 2, 3, 6, 4, 7 }, // 01011101
{ 5, 0, 1, 2, 3, 6, 4, 7 }, // 01011110
{ 0, 1, 2, 3, 4, 6, 5, 7 }, // 01011111
{ 2, 3, 4, 5, 6, 0, 1, 7 }, // 01100000
{ 0, 3, 4, 5, 6, 1, 2, 7 }, // 01100001
{ 3, 0, 4, 5, 6, 1, 2, 7 }, // 01100010
{ 0, 1, 4, 5, 6, 2, 3, 7 }, // 01100011
{ 3, 4, 0, 5, 6, 1, 2, 7 }, // 01100100
{ 0, 4, 1, 5, 6, 2, 3, 7 }, // 01100101
{ 4, 0, 1, 5, 6, 2, 3, 7 }, // 01100110
{ 0, 1, 2, 5, 6, 3, 4, 7 }, // 01100111
{ 3, 4, 5, 0, 6, 1, 2, 7 }, // 01101000
{ 0, 4, 5, 1, 6, 2, 3, 7 }, // 01101001
{ 4, 0, 5, 1, 6, 2, 3, 7 }, // 01101010
{ 0, 1, 5, 2, 6, 3, 4, 7 }, // 01101011
{ 4, 5, 0, 1, 6, 2, 3, 7 }, // 01101100
{ 0, 5, 1, 2, 6, 3, 4, 7 }, // 01101101
{ 5, 0, 1, 2, 6, 3, 4, 7 }, // 01101110
{ 0, 1, 2, 3, 6, 4, 5, 7 }, // 01101111
{ 3, 4, 5, 6, 0, 1, 2, 7 }, // 01110000
{ 0, 4, 5, 6, 1, 2, 3, 7 }, // 01110001
{ 4, 0, 5, 6, 1, 2, 3, 7 }, // 01110010
{ 0, 1, 5, 6, 2, 3, 4, 7 }, // 01110011
{ 4, 5, 0, 6, 1, 2, 3, 7 }, // 01110100
{ 0, 5, 1, 6, 2, 3, 4, 7 }, // 01110101
{ 5, 0, 1, 6, 2, 3, 4, 7 }, // 01110110
{ 0, 1, 2, 6, 3, 4, 5, 7 }, // 01110111
{ 4, 5, 6, 0, 1, 2, 3, 7 }, // 01111000
{ 0, 5, 6, 1, 2, 3, 4, 7 }, // 01111001
{ 5, 0, 6, 1, 2, 3, 4, 7 }, // 01111010
{ 0, 1, 6, 2, 3, 4, 5, 7 }, // 01111011
{ 5, 6, 0, 1, 2, 3, 4, 7 }, // 01111100
{ 0, 6, 1, 2, 3, 4, 5, 7 }, // 01111101
{ 6, 0, 1, 2, 3, 4, 5, 7 }, // 01111110
{ 0, 1, 2, 3, 4, 5, 6, 7 }, // 01111111
{ 1, 2, 3, 4, 5, 6, 7, 0 }, // 10000000
{ 0, 2, 3, 4, 5, 6, 7, 1 }, // 10000001
{ 2, 0, 3, 4, 5, 6, 7, 1 }, // 10000010
{ 0, 1, 3, 4, 5, 6, 7, 2 }, // 10000011
{ 2, 3, 0, 4, 5, 6, 7, 1 }, // 10000100
{ 0, 3, 1, 4, 5, 6, 7, 2 }, // 10000101
{ 3, 0, 1, 4, 5, 6, 7, 2 }, // 10000110
{ 0, 1, 2, 4, 5, 6, 7, 3 }, // 10000111
{ 2, 3, 4, 0, 5, 6, 7, 1 }, // 10001000
{ 0, 3, 4, 1, 5, 6, 7, 2 }, // 10001001
{ 3, 0, 4, 1, 5, 6, 7, 2 }, // 10001010
{ 0, 1, 4, 2, 5, 6, 7, 3 }, // 10001011
{ 3, 4, 0, 1, 5, 6, 7, 2 }, // 10001100
{ 0, 4, 1, 2, 5, 6, 7, 3 }, // 10001101
{ 4, 0, 1, 2, 5, 6, 7, 3 }, // 10001110
{ 0, 1, 2, 3, 5, 6, 7, 4 }, // 10001111
{ 2, 3, 4, 5, 0, 6, 7, 1 }, // 10010000
{ 0, 3, 4, 5, 1, 6, 7, 2 }, // 10010001
{ 3, 0, 4, 5, 1, 6, 7, 2 }, // 10010010
{ 0, 1, 4, 5, 2, 6, 7, 3 }, // 10010011
{ 3, 4, 0, 5, 1, 6, 7, 2 }, // 10010100
{ 0, 4, 1, 5, 2, 6, 7, 3 }, // 10010101
{ 4, 0, 1, 5, 2, 6, 7, 3 }, // 10010110
{ 0, 1, 2, 5, 3, 6, 7, 4 }, // 10010111
{ 3, 4, 5, 0, 1, 6, 7, 2 }, // 10011000
{ 0, 4, 5, 1, 2, 6, 7, 3 }, // 10011001
{ 4, 0, 5, 1, 2, 6, 7, 3 }, // 10011010
{ 0, 1, 5, 2, 3, 6, 7, 4 }, // 10011011
{ 4, 5, 0, 1, 2, 6, 7, 3 }, // 10011100
{ 0, 5, 1, 2, 3, 6, 7, 4 }, // 10011101
{ 5, 0, 1, 2, 3, 6, 7, 4 }, // 10011110
{ 0, 1, 2, 3, 4, 6, 7, 5 }, // 10011111
{ 2, 3, 4, 5, 6, 0, 7, 1 }, // 10100000
{ 0, 3, 4, 5, 6, 1, 7, 2 }, // 10100001
{ 3, 0, 4, 5, 6, 1, 7, 2 }, // 10100010
{ 0, 1, 4, 5, 6, 2, 7, 3 }, // 10100011
{ 3, 4, 0, 5, 6, 1, 7, 2 }, // 10100100
{ 0, 4, 1, 5, 6, 2, 7, 3 }, // 10100101
{ 4, 0, 1, 5, 6, 2, 7, 3 }, // 10100110
{ 0, 1, 2, 5, 6, 3, 7, 4 }, // 10100111
{ 3, 4, 5, 0, 6, 1, 7, 2 }, // 10101000
{ 0, 4, 5, 1, 6, 2, 7, 3 }, // 10101001
{ 4, 0, 5, 1, 6, 2, 7, 3 }, // 10101010
{ 0, 1, 5, 2, 6, 3, 7, 4 }, // 10101011
{ 4, 5, 0, 1, 6, 2, 7, 3 }, // 10101100
{ 0, 5, 1, 2, 6, 3, 7, 4 }, // 10101101
{ 5, 0, 1, 2, 6, 3, 7, 4 }, // 10101110
{ 0, 1, 2, 3, 6, 4, 7, 5 }, // 10101111
{ 3, 4, 5, 6, 0, 1, 7, 2 }, // 10110000
{ 0, 4, 5, 6, 1, 2, 7, 3 }, // 10110001
{ 4, 0, 5, 6, 1, 2, 7, 3 }, // 10110010
{ 0, 1, 5, 6, 2, 3, 7, 4 }, // 10110011
{ 4, 5, 0, 6, 1, 2, 7, 3 }, // 10110100
{ 0, 5, 1, 6, 2, 3, 7, 4 }, // 10110101
{ 5, 0, 1, 6, 2, 3, 7, 4 }, // 10110110
{ 0, 1, 2, 6, 3, 4, 7, 5 }, // 10110111
{ 4, 5, 6, 0, 1, 2, 7, 3 }, // 10111000
{ 0, 5, 6, 1, 2, 3, 7, 4 }, // 10111001
{ 5, 0, 6, 1, 2, 3, 7, 4 }, // 10111010
{ 0, 1, 6, 2, 3, 4, 7, 5 }, // 10111011
{ 5, 6, 0, 1, 2, 3, 7, 4 }, // 10111100
{ 0, 6, 1, 2, 3, 4, 7, 5 }, // 10111101
{ 6, 0, 1, 2, 3, 4, 7, 5 }, // 10111110
{ 0, 1, 2, 3, 4, 5, 7, 6 }, // 10111111
{ 2, 3, 4, 5, 6, 7, 0, 1 }, // 11000000
{ 0, 3, 4, 5, 6, 7, 1, 2 }, // 11000001
{ 3, 0, 4, 5, 6, 7, 1, 2 }, // 11000010
{ 0, 1, 4, 5, 6, 7, 2, 3 }, // 11000011
{ 3, 4, 0, 5, 6, 7, 1, 2 }, // 11000100
{ 0, 4, 1, 5, 6, 7, 2, 3 }, // 11000101
{ 4, 0, 1, 5, 6, 7, 2, 3 }, // 11000110
{ 0, 1, 2, 5, 6, 7, 3, 4 }, // 11000111
{ 3, 4, 5, 0, 6, 7, 1, 2 }, // 11001000
{ 0, 4, 5, 1, 6, 7, 2, 3 }, // 11001001
{ 4, 0, 5, 1, 6, 7, 2, 3 }, // 11001010
{ 0, 1, 5, 2, 6, 7, 3, 4 }, // 11001011
{ 4, 5, 0, 1, 6, 7, 2, 3 }, // 11001100
{ 0, 5, 1, 2, 6, 7, 3, 4 }, // 11001101
{ 5, 0, 1, 2, 6, 7, 3, 4 }, // 11001110
{ 0, 1, 2, 3, 6, 7, 4, 5 }, // 11001111
{ 3, 4, 5, 6, 0, 7, 1, 2 }, // 11010000
{ 0, 4, 5, 6, 1, 7, 2, 3 }, // 11010001
{ 4, 0, 5, 6, 1, 7, 2, 3 }, // 11010010
{ 0, 1, 5, 6, 2, 7, 3, 4 }, // 11010011
{ 4, 5, 0, 6, 1, 7, 2, 3 }, // 11010100
{ 0, 5, 1, 6, 2, 7, 3, 4 }, // 11010101
{ 5, 0, 1, 6, 2, 7, 3, 4 }, // 11010110
{ 0, 1, 2, 6, 3, 7, 4, 5 }, // 11010111
{ 4, 5, 6, 0, 1, 7, 2, 3 }, // 11011000
{ 0, 5, 6, 1, 2, 7, 3, 4 }, // 11011001
{ 5, 0, 6, 1, 2, 7, 3, 4 }, // 11011010
{ 0, 1, 6, 2, 3, 7, 4, 5 }, // 11011011
{ 5, 6, 0, 1, 2, 7, 3, 4 }, // 11011100
{ 0, 6, 1, 2, 3, 7, 4, 5 }, // 11011101
{ 6, 0, 1, 2, 3, 7, 4, 5 }, // 11011110
{ 0, 1, 2, 3, 4, 7, 5, 6 }, // 11011111
{ 3, 4, 5, 6, 7, 0, 1, 2 }, // 11100000
{ 0, 4, 5, 6, 7, 1, 2, 3 }, // 11100001
{ 4, 0, 5, 6, 7, 1, 2, 3 }, // 11100010
{ 0, 1, 5, 6, 7, 2, 3, 4 }, // 11100011
{ 4, 5, 0, 6, 7, 1, 2, 3 }, // 11100100
{ 0, 5, 1, 6, 7, 2, 3, 4 }, // 11100101
{ 5, 0, 1, 6, 7, 2, 3, 4 }, // 11100110
{ 0, 1, 2, 6, 7, 3, 4, 5 }, // 11100111
{ 4, 5, 6, 0, 7, 1, 2, 3 }, // 11101000
{ 0, 5, 6, 1, 7, 2, 3, 4 }, // 11101001
{ 5, 0, 6, 1, 7, 2, 3, 4 }, // 11101010
{ 0, 1, 6, 2, 7, 3, 4, 5 }, // 11101011
{ 5, 6, 0, 1, 7, 2, 3, 4 }, // 11101100
{ 0, 6, 1, 2, 7, 3, 4, 5 }, // 11101101
{ 6, 0, 1, 2, 7, 3, 4, 5 }, // 11101110
{ 0, 1, 2, 3, 7, 4, 5, 6 }, // 11101111
{ 4, 5, 6, 7, 0, 1, 2, 3 }, // 11110000
{ 0, 5, 6, 7, 1, 2, 3, 4 }, // 11110001
{ 5, 0, 6, 7, 1, 2, 3, 4 }, // 11110010
{ 0, 1, 6, 7, 2, 3, 4, 5 }, // 11110011
{ 5, 6, 0, 7, 1, 2, 3, 4 }, // 11110100
{ 0, 6, 1, 7, 2, 3, 4, 5 }, // 11110101
{ 6, 0, 1, 7, 2, 3, 4, 5 }, // 11110110
{ 0, 1, 2, 7, 3, 4, 5, 6 }, // 11110111
{ 5, 6, 7, 0, 1, 2, 3, 4 }, // 11111000
{ 0, 6, 7, 1, 2, 3, 4, 5 }, // 11111001
{ 6, 0, 7, 1, 2, 3, 4, 5 }, // 11111010
{ 0, 1, 7, 2, 3, 4, 5, 6 }, // 11111011
{ 6, 7, 0, 1, 2, 3, 4, 5 }, // 11111100
{ 0, 7, 1, 2, 3, 4, 5, 6 }, // 11111101
{ 7, 0, 1, 2, 3, 4, 5, 6 }, // 11111110
{ 0, 1, 2, 3, 4, 5, 6, 7 } // 11111111
};
assert( uPhase > 0 && uPhase < (unsigned)(1 << nVars) );
// the same function
if ( Cases[uPhase] == 0 )
{
int i;
for ( i = 0; i < nWords; i++ )
puTruthR[i] = puTruth[i];
return;
}
// an elementary variable
if ( Cases[uPhase] > 0 )
{
int i;
for ( i = 0; i < nWords; i++ )
puTruthR[i] = uTruths[(int)Cases[uPhase]][i];
return;
}
// truth table takes one word
if ( nWords == 1 )
{
int i, k, nMints, iRes;
char * pPerm = Perms[uPhase];
puTruthR[0] = 0;
nMints = (1 << nVars);
for ( i = 0; i < nMints; i++ )
if ( puTruth[0] & (1 << i) )
{
for ( iRes = 0, k = 0; k < nVars; k++ )
if ( i & (1 << pPerm[k]) )
iRes |= (1 << k);
puTruthR[0] |= (1 << iRes);
}
return;
}
else if ( nWords == 2 )
{
int i, k, iRes;
char * pPerm = Perms[uPhase];
puTruthR[0] = puTruthR[1] = 0;
for ( i = 0; i < 32; i++ )
{
if ( puTruth[0] & (1 << i) )
{
for ( iRes = 0, k = 0; k < 6; k++ )
if ( i & (1 << pPerm[k]) )
iRes |= (1 << k);
if ( iRes < 32 )
puTruthR[0] |= (1 << iRes);
else
puTruthR[1] |= (1 << (iRes-32));
}
}
for ( ; i < 64; i++ )
{
if ( puTruth[1] & (1 << (i-32)) )
{
for ( iRes = 0, k = 0; k < 6; k++ )
if ( i & (1 << pPerm[k]) )
iRes |= (1 << k);
if ( iRes < 32 )
puTruthR[0] |= (1 << iRes);
else
puTruthR[1] |= (1 << (iRes-32));
}
}
}
// truth table takes more than one word
else
{
int i, k, nMints, iRes;
char * pPerm = Perms[uPhase];
for ( i = 0; i < nWords; i++ )
puTruthR[i] = 0;
nMints = (1 << nVars);
for ( i = 0; i < nMints; i++ )
if ( puTruth[i>>5] & (1 << (i&31)) )
{
for ( iRes = 0, k = 0; k < 5; k++ )
if ( i & (1 << pPerm[k]) )
iRes |= (1 << k);
puTruthR[iRes>>5] |= (1 << (iRes&31));
}
}
}
/**Function*************************************************************
Synopsis [Allocated lookup table for truth table permutation.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned short ** Extra_TruthPerm43()
{
unsigned short ** pTable;
unsigned uTruth;
int i, k;
pTable = (unsigned short **)Extra_ArrayAlloc( 256, 16, 2 );
for ( i = 0; i < 256; i++ )
{
uTruth = (i << 8) | i;
for ( k = 0; k < 16; k++ )
pTable[i][k] = Extra_TruthPerm4One( uTruth, k );
}
return pTable;
}
/**Function*************************************************************
Synopsis [Allocated lookup table for truth table permutation.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned ** Extra_TruthPerm53()
{
unsigned ** pTable;
unsigned uTruth;
int i, k;
pTable = (unsigned **)Extra_ArrayAlloc( 256, 32, 4 );
for ( i = 0; i < 256; i++ )
{
uTruth = (i << 24) | (i << 16) | (i << 8) | i;
for ( k = 0; k < 32; k++ )
pTable[i][k] = Extra_TruthPerm5One( uTruth, k );
}
return pTable;
}
/**Function*************************************************************
Synopsis [Allocated lookup table for truth table permutation.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned ** Extra_TruthPerm54()
{
unsigned ** pTable;
unsigned uTruth;
int i;
pTable = (unsigned **)Extra_ArrayAlloc( 256*256, 4, 4 );
for ( i = 0; i < 256*256; i++ )
{
uTruth = (i << 16) | i;
pTable[i][0] = Extra_TruthPerm5One( uTruth, 31-8 );
pTable[i][1] = Extra_TruthPerm5One( uTruth, 31-4 );
pTable[i][2] = Extra_TruthPerm5One( uTruth, 31-2 );
pTable[i][3] = Extra_TruthPerm5One( uTruth, 31-1 );
}
return pTable;
}
/**Function*************************************************************
Synopsis [Allocated lookup table for truth table permutation.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned ** Extra_TruthPerm63()
{
unsigned ** pTable;
unsigned uTruth[2];
int i, k;
pTable = (unsigned **)Extra_ArrayAlloc( 256, 64, 8 );
for ( i = 0; i < 256; i++ )
{
uTruth[0] = (i << 24) | (i << 16) | (i << 8) | i;
uTruth[1] = uTruth[0];
for ( k = 0; k < 64; k++ )
Extra_TruthPerm6One( uTruth, k, &pTable[i][k] );
}
return pTable;
}
/**Function*************************************************************
Synopsis [Returns the pointer to the elementary truth tables.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
unsigned ** Extra_Truths8()
{
static unsigned uTruths[8][8] = {
{ 0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA,0xAAAAAAAA },
{ 0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC,0xCCCCCCCC },
{ 0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0,0xF0F0F0F0 },
{ 0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00,0xFF00FF00 },
{ 0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000,0xFFFF0000 },
{ 0x00000000,0xFFFFFFFF,0x00000000,0xFFFFFFFF,0x00000000,0xFFFFFFFF,0x00000000,0xFFFFFFFF },
{ 0x00000000,0x00000000,0xFFFFFFFF,0xFFFFFFFF,0x00000000,0x00000000,0xFFFFFFFF,0xFFFFFFFF },
{ 0x00000000,0x00000000,0x00000000,0x00000000,0xFFFFFFFF,0xFFFFFFFF,0xFFFFFFFF,0xFFFFFFFF }
};
static unsigned * puResult[8] = {
uTruths[0], uTruths[1], uTruths[2], uTruths[3], uTruths[4], uTruths[5], uTruths[6], uTruths[7]
};
return (unsigned **)puResult;
}
/**Function*************************************************************
Synopsis [Bubble-sorts components by scores in increasing order.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
void Extra_BubbleSort( int Order[], int Costs[], int nSize, int fIncreasing )
{
int i, Temp, fChanges;
assert( nSize < 1000 );
for ( i = 0; i < nSize; i++ )
Order[i] = i;
if ( fIncreasing )
{
do {
fChanges = 0;
for ( i = 0; i < nSize - 1; i++ )
{
if ( Costs[Order[i]] <= Costs[Order[i+1]] )
continue;
Temp = Order[i];
Order[i] = Order[i+1];
Order[i+1] = Temp;
fChanges = 1;
}
} while ( fChanges );
}
else
{
do {
fChanges = 0;
for ( i = 0; i < nSize - 1; i++ )
{
if ( Costs[Order[i]] >= Costs[Order[i+1]] )
continue;
Temp = Order[i];
Order[i] = Order[i+1];
Order[i+1] = Temp;
fChanges = 1;
}
} while ( fChanges );
}
}
/*---------------------------------------------------------------------------*/
/* Definition of internal functions */
/*---------------------------------------------------------------------------*/
/*---------------------------------------------------------------------------*/
/* Definition of static Functions */
/*---------------------------------------------------------------------------*/
/**Function*************************************************************
Synopsis [Computes the permutation table for 8 variables.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
void Extra_TruthExpandGeneratePermTable()
{
int i, k, nOnes, Last1, First0;
int iOne, iZero;
printf( "\nstatic char Cases[256] = {\n" );
for ( i = 0; i < 256; i++ )
{
nOnes = 0;
Last1 = First0 = -1;
for ( k = 0; k < 8; k++ )
{
if ( i & (1 << k) )
{
nOnes++;
Last1 = k;
}
else if ( First0 == -1 )
First0 = k;
}
if ( Last1 + 1 == First0 || i == 255 )
printf( " %d%s", 0, (i==255? " ":",") );
else if ( nOnes == 1 )
printf( " %d,", Last1 );
else
printf( " -%d,", 1 );
printf( " // " );
Extra_PrintBinary( stdout, (unsigned*)&i, 8 );
printf( "\n" );
}
printf( "};\n" );
printf( "\nstatic char Perms[256][8] = {\n" );
for ( i = 0; i < 256; i++ )
{
printf( " {" );
nOnes = 0;
for ( k = 0; k < 8; k++ )
if ( i & (1 << k) )
nOnes++;
iOne = 0;
iZero = nOnes;
for ( k = 0; k < 8; k++ )
if ( i & (1 << k) )
printf( "%s %d", (k==0? "":","), iOne++ );
else
printf( "%s %d", (k==0? "":","), iZero++ );
assert( iOne + iZero == 8 );
printf( " }%s // ", (i==255? " ":",") );
Extra_PrintBinary( stdout, (unsigned*)&i, 8 );
printf( "\n" );
}
printf( "};\n" );
}
/**Function*************************************************************
Synopsis [Computes complementation schedule for 2^n Grey codes.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
int * Extra_GreyCodeSchedule( int n )
{
int * pRes = ABC_ALLOC( int, (1<<n) );
int i, k, b = 0;
// pRes[b++] = -1;
for ( k = 0; k < n; k++ )
for ( pRes[b++] = k, i = 1; i < (1<<k); i++ )
pRes[b++] = pRes[i-1]; // pRes[i];
pRes[b++] = n-1;
assert( b == (1<<n) );
if ( 0 )
{
unsigned uSign = 0;
for ( b = 0; b < (1<<n); b++ )
{
uSign ^= (1 << pRes[b]);
printf( "%3d %3d ", b, pRes[b] );
Extra_PrintBinary( stdout, &uSign, n );
printf( "\n" );
}
}
return pRes;
}
/**Function*************************************************************
Synopsis [Computes permutation schedule for n! permutations.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
int * Extra_PermSchedule( int n )
{
int nFact = Extra_Factorial(n);
int nGroups = nFact / n / 2;
int * pRes = ABC_ALLOC( int, nFact );
int * pRes0, i, k, b = 0;
assert( n > 1 );
if ( n == 2 )
{
pRes[0] = pRes[1] = 0;
return pRes;
}
pRes0 = Extra_PermSchedule( n-1 );
for ( k = 0; k < nGroups; k++ )
{
for ( i = n-1; i > 0; i-- )
pRes[b++] = i-1;
pRes[b++] = pRes0[2*k]+1;
for ( i = 0; i < n-1; i++ )
pRes[b++] = i;
pRes[b++] = pRes0[2*k+1];
}
ABC_FREE( pRes0 );
assert( b == nFact );
if ( 0 )
{
int Perm[16];
for ( i = 0; i < n; i++ )
Perm[i] = i;
for ( b = 0; b < nFact; b++ )
{
ABC_SWAP( int, Perm[pRes[b]], Perm[pRes[b]+1] );
printf( "%3d %3d ", b, pRes[b] );
for ( i = 0; i < n; i++ )
printf( "%d", Perm[i] );
printf( "\n" );
}
}
return pRes;
}
/**Function*************************************************************
Synopsis [Finds minimum form of a 6-input function.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
static inline word Extra_Truth6SwapAdjacent( word t, int v )
{
// variable swapping code
static word PMasks[5][3] = {
{ ABC_CONST(0x9999999999999999), ABC_CONST(0x2222222222222222), ABC_CONST(0x4444444444444444) },
{ ABC_CONST(0xC3C3C3C3C3C3C3C3), ABC_CONST(0x0C0C0C0C0C0C0C0C), ABC_CONST(0x3030303030303030) },
{ ABC_CONST(0xF00FF00FF00FF00F), ABC_CONST(0x00F000F000F000F0), ABC_CONST(0x0F000F000F000F00) },
{ ABC_CONST(0xFF0000FFFF0000FF), ABC_CONST(0x0000FF000000FF00), ABC_CONST(0x00FF000000FF0000) },
{ ABC_CONST(0xFFFF00000000FFFF), ABC_CONST(0x00000000FFFF0000), ABC_CONST(0x0000FFFF00000000) }
};
assert( v < 5 );
return (t & PMasks[v][0]) | ((t & PMasks[v][1]) << (1 << v)) | ((t & PMasks[v][2]) >> (1 << v));
}
static inline word Extra_Truth6ChangePhase( word t, int v )
{
// elementary truth tables
static word Truth6[6] = {
ABC_CONST(0xAAAAAAAAAAAAAAAA),
ABC_CONST(0xCCCCCCCCCCCCCCCC),
ABC_CONST(0xF0F0F0F0F0F0F0F0),
ABC_CONST(0xFF00FF00FF00FF00),
ABC_CONST(0xFFFF0000FFFF0000),
ABC_CONST(0xFFFFFFFF00000000)
};
assert( v < 6 );
return ((t & ~Truth6[v]) << (1 << v)) | ((t & Truth6[v]) >> (1 << v));
}
word Extra_Truth6MinimumExact( word t, int * pComp, int * pPerm )
{
word tMin = ~(word)0;
word tCur, tTemp1, tTemp2;
int i, p, c;
for ( i = 0; i < 2; i++ )
{
tCur = i ? ~t : t;
tTemp1 = tCur;
for ( p = 0; p < 720; p++ )
{
// printf( "Trying perm %d:\n", p );
// Kit_DsdPrintFromTruth( &tCur, 6 ), printf( "\n" );;
tTemp2 = tCur;
for ( c = 0; c < 64; c++ )
{
tMin = Abc_MinWord( tMin, tCur );
tCur = Extra_Truth6ChangePhase( tCur, pComp[c] );
}
assert( tTemp2 == tCur );
tCur = Extra_Truth6SwapAdjacent( tCur, pPerm[p] );
}
assert( tTemp1 == tCur );
}
return tMin;
}
/**Function*************************************************************
Synopsis [Perform heuristic TT minimization.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
static inline int Extra_Truth6Ones( word t )
{
t = (t & ABC_CONST(0x5555555555555555)) + ((t>> 1) & ABC_CONST(0x5555555555555555));
t = (t & ABC_CONST(0x3333333333333333)) + ((t>> 2) & ABC_CONST(0x3333333333333333));
t = (t & ABC_CONST(0x0F0F0F0F0F0F0F0F)) + ((t>> 4) & ABC_CONST(0x0F0F0F0F0F0F0F0F));
t = (t & ABC_CONST(0x00FF00FF00FF00FF)) + ((t>> 8) & ABC_CONST(0x00FF00FF00FF00FF));
t = (t & ABC_CONST(0x0000FFFF0000FFFF)) + ((t>>16) & ABC_CONST(0x0000FFFF0000FFFF));
return (t & ABC_CONST(0x00000000FFFFFFFF)) + (t>>32);
}
static inline word Extra_Truth6MinimumRoundOne( word t, int v )
{
word tCur, tMin = t; // ab
assert( v >= 0 && v < 5 );
tCur = Extra_Truth6ChangePhase( t, v ); // !ab
tMin = Abc_MinWord( tMin, tCur );
tCur = Extra_Truth6ChangePhase( t, v+1 ); // a!b
tMin = Abc_MinWord( tMin, tCur );
tCur = Extra_Truth6ChangePhase( tCur, v ); // !a!b
tMin = Abc_MinWord( tMin, tCur );
t = Extra_Truth6SwapAdjacent( t, v ); // ba
tMin = Abc_MinWord( tMin, t );
tCur = Extra_Truth6ChangePhase( t, v ); // !ba
tMin = Abc_MinWord( tMin, tCur );
tCur = Extra_Truth6ChangePhase( t, v+1 ); // b!a
tMin = Abc_MinWord( tMin, tCur );
tCur = Extra_Truth6ChangePhase( tCur, v ); // !b!a
tMin = Abc_MinWord( tMin, tCur );
return tMin;
}
static inline word Extra_Truth6MinimumRoundMany( word t )
{
int i, k, Limit = 10;
word tCur, tMin = t;
for ( i = 0; i < Limit; i++ )
{
word tMin0 = tMin;
for ( k = 4; k >= 0; k-- )
{
tCur = Extra_Truth6MinimumRoundOne( tMin, k );
tMin = Abc_MinWord( tMin, tCur );
}
if ( tMin0 == tMin )
break;
}
return tMin;
}
word Extra_Truth6MinimumHeuristic( word t )
{
word tMin1, tMin2;
int nOnes = Extra_Truth6Ones( t );
if ( nOnes < 32 )
return Extra_Truth6MinimumRoundMany( t );
if ( nOnes > 32 )
return Extra_Truth6MinimumRoundMany( ~t );
tMin1 = Extra_Truth6MinimumRoundMany( t );
tMin2 = Extra_Truth6MinimumRoundMany( ~t );
return Abc_MinWord( tMin1, tMin2 );
}
void Extra_Truth6MinimumHeuristicTest()
{
word t = ABC_CONST(0x5555555555555555) & ~(ABC_CONST(0x3333333333333333) & ABC_CONST(0x0F0F0F0F0F0F0F0F));
Extra_Truth6MinimumRoundMany( t );
t = 0;
}
/**Function*************************************************************
Synopsis [Reads functions from file.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
word * Extra_NpnRead( char * pFileName, int nFuncs )
{
FILE * pFile;
word * pFuncs;
char pBuffer[100];
int i = 0;
pFuncs = ABC_CALLOC( word, nFuncs );
pFile = fopen( pFileName, "rb" );
while ( fgets( pBuffer, 100, pFile ) )
Extra_ReadHex( (unsigned *)(pFuncs + i++), (pBuffer[1] == 'x' ? pBuffer+2 : pBuffer), 16 );
fclose( pFile );
assert( i == nFuncs );
for ( i = 0; i < Abc_MinInt(nFuncs, 10); i++ )
{
printf( "Line %d : ", i );
Extra_PrintHex( stdout, (unsigned *)(pFuncs + i), 6 ), printf( "\n" );
}
return pFuncs;
}
/**Function*************************************************************
Synopsis [Comparison for words.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
int CompareWords( void * p1, void * p2 )
{
word Word1 = *(word *)p1;
word Word2 = *(word *)p2;
if ( Word1 < Word2 )
return -1;
if ( Word1 > Word2 )
return 1;
return 0;
}
/**Function*************************************************************
Synopsis [Computes the permutation table for 8 variables.]
Description []
SideEffects []
SeeAlso []
***********************************************************************/
void Extra_NpnTest1()
{
int * pComp;
pComp = Extra_PermSchedule( 5 );
// pComp = Extra_GreyCodeSchedule( 5 );
ABC_FREE( pComp );
}
void Extra_NpnTest2()
{
int * pComp, * pPerm;
word tMin, t = ABC_CONST(0xa2222aaa08888000);
pComp = Extra_GreyCodeSchedule( 6 );
pPerm = Extra_PermSchedule( 6 );
tMin = Extra_Truth6MinimumExact( t, pComp, pPerm );
ABC_FREE( pPerm );
ABC_FREE( pComp );
Extra_PrintHex( stdout, (unsigned *)&t, 6 ), printf( "\n" );
Extra_PrintHex( stdout, (unsigned *)&tMin, 6 ), printf( "\n" );
}
void Extra_NpnTest()
{
// int nFuncs = 5687661;
// int nFuncs = 400777;
int nFuncs = 10;
abctime clk = Abc_Clock();
word * pFuncs;
int * pComp, * pPerm;
int i;//, k, nUnique = 0;
/*
// read functions
pFuncs = Extra_NpnRead( "C:\\_projects\\abc\\_TEST\\allan\\lib6var5M.txt", nFuncs );
// pFuncs = Extra_NpnRead( "C:\\_projects\\abc\\_TEST\\allan\\lib6var5M_out_Total_minimal.txt", nFuncs );
qsort( (void *)pFuncs, nFuncs, sizeof(word), (int(*)(const void *,const void *))CompareWords );
// count unique
k = 1;
for ( i = 1; i < nFuncs; i++ )
if ( pFuncs[i] != pFuncs[i-1] )
pFuncs[k++] = pFuncs[i];
nFuncs = k;
printf( "Total number of unique functions = %d\n", nFuncs );
*/
// pFuncs = Extra_NpnRead( "C:\\_projects\\abc\\_TEST\\allan\\lib6var5M_out_Total_minimal.txt", nFuncs );
pFuncs = Extra_NpnRead( "C:\\_projects\\abc\\_TEST\\allan\\test.txt", nFuncs );
pComp = Extra_GreyCodeSchedule( 6 );
pPerm = Extra_PermSchedule( 6 );
// compute minimum forms
for ( i = 0; i < nFuncs; i++ )
{
pFuncs[i] = Extra_Truth6MinimumExact( pFuncs[i], pComp, pPerm );
if ( i % 10000 == 0 )
printf( "%d\n", i );
}
printf( "Finished deriving minimum form\n" );
/*
// sort them by value
qsort( (void *)pFuncs, nFuncs, sizeof(word), (int(*)(const void *,const void *))CompareWords );
// count unique
nUnique = nFuncs;
for ( i = 1; i < nFuncs; i++ )
if ( pFuncs[i] == pFuncs[i-1] )
nUnique--;
printf( "Total number of unique ones = %d\n", nUnique );
*/
for ( i = 0; i < Abc_MinInt(nFuncs, 10); i++ )
{
printf( "Line %d : ", i );
Extra_PrintHex( stdout, (unsigned *)(pFuncs + i), 6 ), printf( "\n" );
}
ABC_FREE( pPerm );
ABC_FREE( pComp );
ABC_FREE( pFuncs );
Abc_PrintTime( 1, "Time", Abc_Clock() - clk );
}
////////////////////////////////////////////////////////////////////////
/// END OF FILE ///
////////////////////////////////////////////////////////////////////////
ABC_NAMESPACE_IMPL_END